Chords for fin - Make Me Cry [OFFICIAL VIDEO]
Tempo:
107.95 bpm
Chords used:
F
C
Gm
Cm
Am
Tuning:Standard Tuning (EADGBE)Capo:+0fret
![fin - Make Me Cry [OFFICIAL VIDEO] chords](https://i.ytimg.com/vi/ZiqgdrAPbC0/mqdefault.jpg)
Jam Along & Learn...
[F] Throw yourself back, you were better back [Gm] then
to pretend
say a lot of words but they don't make [Cm] sense
[F] in the end
time not to drop off home at 3 o [Gm]'clock in the morning
[F] with you
It's never a good idea to show what you [C] have in your mind
[F] me too
to pretend
say a lot of words but they don't make [Cm] sense
[F] in the end
time not to drop off home at 3 o [Gm]'clock in the morning
[F] with you
It's never a good idea to show what you [C] have in your mind
[F] me too
100% ➙ 108BPM
F
C
Gm
Cm
Am
F
C
Gm
_ _ _ _ _ _ _ _
_ _ _ _ _ _ _ _
[F] Throw yourself back, you were better back [Gm] then
But then you started to play dumb and you [F] started to pretend
You [Gm] _ _ [F] _ _
say a lot of words but they don't make [Cm] sense
Now I think I'm better [Am] off by myself [F] in the end
_ [Cm] It's _ [F] _ _
time not to drop off home at 3 o [Gm]'clock in the morning
And I'm [Am] still alone [F] with you
_ _ [C] _ _ _ [F]
It's never a good idea to show what you [C] have in your mind
When you're all alone with [F] me too
_ _ [C] I _ _
[F]-I-I-I-I [Bm]-I-I-I-I-I-I-I-I-I-I-I [F]-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I
Keep your [Gm] secrets [C] to yourself
[F] And put me high [G] up on [C] a shelf
[F] Look at [B] me [Gm] when you [C] are by
[F] Just enough [Gm] to make [C] me [F] cry
_ _ [Gm] Make [C] _ _ _
[F] _ _ _ _ [Bb] _ [C] _ _
[Fm] me cry
_ _ [C] _ _ [F] _ _
The sidewalks cracks you step in my [Gm] back and you [N] look away as the bones begin to crack
_ _ _ _ Keep [F] me healthy, keep me [Gm] strong, don't keep me [C] with you all day [F] long, you're hurting me
Don't look at [Gm] me, don't look at [C] me, don't look at me
Ah [Abm] ah ah ah ah ah [F] ah ah ah ah ah ah
Keep your [Gm] secrets to [C] yourself [F] and put me high [G] up on [C] a shelf
[F] Look at me [Gm] when you [C] are by, [F] just enough [Gm] to make [C] me [F] cry
_ _ [Gm] Keep _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [Cm] _ _
[F] _ _ _ _ [Gm] _ _ [F] _ _
_ _ _ _ [Gm] _ _ [Cm] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [F] _ _
_ your secrets to yourself and put me high [C] up on a shelf
[F] Look at me [C] when you are by, [F] just enough [Gm] to make [C] me [F] cry
_ _ [Gm] Make _ [C] _ [F] _
_ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ [C] _ _
[F] me cry _ _ _ _ _ _
_ _ _ _ _ _ _ _
[F] Throw yourself back, you were better back [Gm] then
But then you started to play dumb and you [F] started to pretend
You [Gm] _ _ [F] _ _
say a lot of words but they don't make [Cm] sense
Now I think I'm better [Am] off by myself [F] in the end
_ [Cm] It's _ [F] _ _
time not to drop off home at 3 o [Gm]'clock in the morning
And I'm [Am] still alone [F] with you
_ _ [C] _ _ _ [F]
It's never a good idea to show what you [C] have in your mind
When you're all alone with [F] me too
_ _ [C] I _ _
[F]-I-I-I-I [Bm]-I-I-I-I-I-I-I-I-I-I-I [F]-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I-I
Keep your [Gm] secrets [C] to yourself
[F] And put me high [G] up on [C] a shelf
[F] Look at [B] me [Gm] when you [C] are by
[F] Just enough [Gm] to make [C] me [F] cry
_ _ [Gm] Make [C] _ _ _
[F] _ _ _ _ [Bb] _ [C] _ _
[Fm] me cry
_ _ [C] _ _ [F] _ _
The sidewalks cracks you step in my [Gm] back and you [N] look away as the bones begin to crack
_ _ _ _ Keep [F] me healthy, keep me [Gm] strong, don't keep me [C] with you all day [F] long, you're hurting me
Don't look at [Gm] me, don't look at [C] me, don't look at me
Ah [Abm] ah ah ah ah ah [F] ah ah ah ah ah ah
Keep your [Gm] secrets to [C] yourself [F] and put me high [G] up on [C] a shelf
[F] Look at me [Gm] when you [C] are by, [F] just enough [Gm] to make [C] me [F] cry
_ _ [Gm] Keep _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [Cm] _ _
[F] _ _ _ _ [Gm] _ _ [F] _ _
_ _ _ _ [Gm] _ _ [Cm] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [F] _ _
_ your secrets to yourself and put me high [C] up on a shelf
[F] Look at me [C] when you are by, [F] just enough [Gm] to make [C] me [F] cry
_ _ [Gm] Make _ [C] _ [F] _
_ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ _ [C] _ _
[F] _ _ _ _ [Gm] _ [C] _ _
[F] me cry _ _ _ _ _ _

![twenty one pilots - Cancer (My Chemical Romance Cover) [Official Lyric Video]](https://i.ytimg.com/vi/yw6i1SAHetc/mqdefault.jpg)





![Ed Sheeran - Shape Of You [Official Lyric Video]](https://i.ytimg.com/vi/_dK2tDK9grQ/mqdefault.jpg)




![Ed Sheeran - Castle On The Hill [Official Lyric Video]](https://i.ytimg.com/vi/7Qp5vcuMIlk/mqdefault.jpg)


![Steffan Argus: Make Me Cry [LYRICS]](https://i.ytimg.com/vi/q0zrvlYH96c/mqdefault.jpg)










![Hayley Kiyoko - Gravel To Tempo [Official Music Video]](https://i.ytimg.com/vi/XOm2rGwmhWg/mqdefault.jpg)